C10H16S — CID 142340205
2-(6-tricyclo[3.2.1.03,8]octanyl)ethanethiol (PubChem CID 142340205) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 2-(6-tricyclo[3.2.1.03,8]octanyl)ethanethiol.
| Compound Name | 2-(6-tricyclo[3.2.1.03,8]octanyl)ethanethiol |
|---|---|
| PubChem CID | 142340205 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-(6-tricyclo[3.2.1.03,8]octanyl)ethanethiol |
| SMILES | SCCC1CC2CC3CC1C23 |
| InChI | InChI=1S/C10H16S/c11-2-1-6-3-7-4-8-5-9(6)10(7)8/h6-11H,1-5H2 |
| InChIKey | SDKBHYZOOUUGRA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|