C21H33NO13 — CID 142342519
acetic acid;ethyl 2-[2-[(3S,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-hydroxyoxan-2-yl]propanoylamino]acetate (PubChem CID 142342519) has the molecular formula C21H33NO13 and a molecular weight of 507.49 g/mol. Its IUPAC name is acetic acid;ethyl 2-[2-[(3S,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-hydroxyoxan-2-yl]propanoylamino]acetate.
| Compound Name | acetic acid;ethyl 2-[2-[(3S,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-hydroxyoxan-2-yl]propanoylamino]acetate |
|---|---|
| PubChem CID | 142342519 |
| Molecular Formula | C21H33NO13 |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | acetic acid;ethyl 2-[2-[(3S,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-hydroxyoxan-2-yl]propanoylamino]acetate |
| SMILES | CC(=O)O.CCOC(=O)CNC(=O)C(C)C1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C19H29NO11.C2H4O2/c1-6-27-14(24)7-20-19(26)9(2)16-15(25)18(30-12(5)23)17(29-11(4)22)13(31-16)8-28-10(3)21;1-2(3)4/h9,13,15-18,25H,6-8H2,1-5H3,(H,20,26);1H3,(H,3,4)/t9?,13-,15+,16?,17-,18-;/m1./s1 |
| InChIKey | KZPTYNAUDWDDPP-GEVQJSOASA-N |
| XLogP | -1.05 |
| TPSA | 201.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|