C15H20O9 — CID 142342544
2-[(6R,7S,7aS)-6,7-diacetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3-yl]ethyl acetate (PubChem CID 142342544) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-[(6R,7S,7aS)-6,7-diacetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3-yl]ethyl acetate.
| Compound Name | 2-[(6R,7S,7aS)-6,7-diacetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 142342544 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-[(6R,7S,7aS)-6,7-diacetyloxy-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1C(=O)O[C@H]2C1OC[C@@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C15H20O9/c1-7(16)20-5-4-10-12-14(24-15(10)19)13(23-9(3)18)11(6-21-12)22-8(2)17/h10-14H,4-6H2,1-3H3/t10?,11-,12?,13+,14+/m1/s1 |
| InChIKey | XOCDCPDJSNRMGO-UTAXJDLNSA-N |
| XLogP | -0.26 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|