C19H28O12 — CID 134969981
dimethyl 2-[(3R,4S,5R)-3,4,5,6-tetraacetyloxyhexyl]propanedioate (PubChem CID 134969981) has the molecular formula C19H28O12 and a molecular weight of 448.42 g/mol. Its IUPAC name is dimethyl 2-[(3R,4S,5R)-3,4,5,6-tetraacetyloxyhexyl]propanedioate.
| Compound Name | dimethyl 2-[(3R,4S,5R)-3,4,5,6-tetraacetyloxyhexyl]propanedioate |
|---|---|
| PubChem CID | 134969981 |
| Molecular Formula | C19H28O12 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | dimethyl 2-[(3R,4S,5R)-3,4,5,6-tetraacetyloxyhexyl]propanedioate |
| SMILES | COC(=O)C(CC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C19H28O12/c1-10(20)28-9-16(30-12(3)22)17(31-13(4)23)15(29-11(2)21)8-7-14(18(24)26-5)19(25)27-6/h14-17H,7-9H2,1-6H3/t15-,16-,17+/m1/s1 |
| InChIKey | TUIZEQZCRMDHBM-ZACQAIPSSA-N |
| XLogP | 0.09 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|