C16H24O8 — CID 540700
ethyl 2-[4,5-diacetyloxy-6-(2-oxopropyl)oxan-3-yl]acetate (PubChem CID 540700) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is ethyl 2-[4,5-diacetyloxy-6-(2-oxopropyl)oxan-3-yl]acetate.
| Compound Name | ethyl 2-[4,5-diacetyloxy-6-(2-oxopropyl)oxan-3-yl]acetate |
|---|---|
| PubChem CID | 540700 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | ethyl 2-[4,5-diacetyloxy-6-(2-oxopropyl)oxan-3-yl]acetate |
| SMILES | CCOC(=O)CC1COC(CC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H24O8/c1-5-21-14(20)7-12-8-22-13(6-9(2)17)16(24-11(4)19)15(12)23-10(3)18/h12-13,15-16H,5-8H2,1-4H3 |
| InChIKey | LZNLNRBTHNUNDZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|