C20H32F2O2 — CID 142342619
1-butoxy-5,6-difluoro-4-[(4-propylcyclohexyl)methoxy]cyclohexa-1,3-diene (PubChem CID 142342619) has the molecular formula C20H32F2O2 and a molecular weight of 342.47 g/mol. Its IUPAC name is 1-butoxy-5,6-difluoro-4-[(4-propylcyclohexyl)methoxy]cyclohexa-1,3-diene.
| Compound Name | 1-butoxy-5,6-difluoro-4-[(4-propylcyclohexyl)methoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142342619 |
| Molecular Formula | C20H32F2O2 |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1-butoxy-5,6-difluoro-4-[(4-propylcyclohexyl)methoxy]cyclohexa-1,3-diene |
| SMILES | CCCCOC1=CC=C(OCC2CCC(CCC)CC2)C(F)C1F |
| InChI | InChI=1S/C20H32F2O2/c1-3-5-13-23-17-11-12-18(20(22)19(17)21)24-14-16-9-7-15(6-4-2)8-10-16/h11-12,15-16,19-20H,3-10,13-14H2,1-2H3 |
| InChIKey | OMKIBNLOBQJWAI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|