About 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne
2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne (PubChem CID 142342996) has the molecular formula C15H14
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne.
Analyze 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne?
The IUPAC name of 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne (CID 142342996) is 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne.
What is the SMILES notation for 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne?
The canonical SMILES for 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne is CCc1ccccc1-c1ccc#cc1C.
What is the InChIKey of 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne?
The InChIKey is SYQQXPNVKKGFHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14/c1-3-13-9-5-7-11-15(13)14-10-6-4-8-12(14)2/h5-7,9-11H,3H2,1-2H3.
What are the key properties of 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne?
2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne has a molecular weight of 194.28 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylphenyl)-1-methylcyclohexa-1,3-dien-5-yne is sourced from PubChem (CID 142342996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).