C14H21FN2O — CID 142344711
N-cyclopropyl-4-fluoro-3-(methylaminomethyl)benzamide;ethane (PubChem CID 142344711) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is N-cyclopropyl-4-fluoro-3-(methylaminomethyl)benzamide;ethane.
| Compound Name | N-cyclopropyl-4-fluoro-3-(methylaminomethyl)benzamide;ethane |
|---|---|
| PubChem CID | 142344711 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-cyclopropyl-4-fluoro-3-(methylaminomethyl)benzamide;ethane |
| SMILES | CC.CNCc1cc(C(=O)NC2CC2)ccc1F |
| InChI | InChI=1S/C12H15FN2O.C2H6/c1-14-7-9-6-8(2-5-11(9)13)12(16)15-10-3-4-10;1-2/h2,5-6,10,14H,3-4,7H2,1H3,(H,15,16);1-2H3 |
| InChIKey | BESGYGHVLCGDSJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |