C31H38N6O — CID 142349600
(3E)-3-[4-[2,4-dimethyl-5-(3-methyl-4-pyridin-2-ylpiperazine-1-carbonyl)anilino]piperidin-1-yl]-2-methylidenehexa-3,5-dienenitrile (PubChem CID 142349600) has the molecular formula C31H38N6O and a molecular weight of 510.69 g/mol. Its IUPAC name is (3E)-3-[4-[2,4-dimethyl-5-(3-methyl-4-pyridin-2-ylpiperazine-1-carbonyl)anilino]piperidin-1-yl]-2-methylidenehexa-3,5-dienenitrile.
| Compound Name | (3E)-3-[4-[2,4-dimethyl-5-(3-methyl-4-pyridin-2-ylpiperazine-1-carbonyl)anilino]piperidin-1-yl]-2-methylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142349600 |
| Molecular Formula | C31H38N6O |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | (3E)-3-[4-[2,4-dimethyl-5-(3-methyl-4-pyridin-2-ylpiperazine-1-carbonyl)anilino]piperidin-1-yl]-2-methylidenehexa-3,5-dienenitrile |
| SMILES | C=C/C=C(\C(=C)C#N)N1CCC(Nc2cc(C(=O)N3CCN(c4ccccn4)C(C)C3)c(C)cc2C)CC1 |
| InChI | InChI=1S/C31H38N6O/c1-6-9-29(24(4)20-32)35-14-11-26(12-15-35)34-28-19-27(22(2)18-23(28)3)31(38)36-16-17-37(25(5)21-36)30-10-7-8-13-33-30/h6-10,13,18-19,25-26,34H,1,4,11-12,14-17,21H2,2-3,5H3/b29-9+ |
| InChIKey | LGPMJDOWQIOFPG-GESPGMLMSA-N |
| XLogP | 5.08 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|