C34H38N6O2 — CID 155322595
(E,2E)-3-[4-[2,4-dimethyl-5-[4-(2-oxo-1,3-dihydroindol-7-yl)piperazine-1-carbonyl]anilino]piperidin-1-yl]-2-ethylidenehex-3-en-5-ynenitrile (PubChem CID 155322595) has the molecular formula C34H38N6O2 and a molecular weight of 562.72 g/mol. Its IUPAC name is (E,2E)-3-[4-[2,4-dimethyl-5-[4-(2-oxo-1,3-dihydroindol-7-yl)piperazine-1-carbonyl]anilino]piperidin-1-yl]-2-ethylidenehex-3-en-5-ynenitrile.
| Compound Name | (E,2E)-3-[4-[2,4-dimethyl-5-[4-(2-oxo-1,3-dihydroindol-7-yl)piperazine-1-carbonyl]anilino]piperidin-1-yl]-2-ethylidenehex-3-en-5-ynenitrile |
|---|---|
| PubChem CID | 155322595 |
| Molecular Formula | C34H38N6O2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | (E,2E)-3-[4-[2,4-dimethyl-5-[4-(2-oxo-1,3-dihydroindol-7-yl)piperazine-1-carbonyl]anilino]piperidin-1-yl]-2-ethylidenehex-3-en-5-ynenitrile |
| SMILES | C#C/C=C(C(\C#N)=C/C)/N1CCC(Nc2cc(C(=O)N3CCN(c4cccc5c4NC(=O)C5)CC3)c(C)cc2C)CC1 |
| InChI | InChI=1S/C34H38N6O2/c1-5-8-30(25(6-2)22-35)38-13-11-27(12-14-38)36-29-21-28(23(3)19-24(29)4)34(42)40-17-15-39(16-18-40)31-10-7-9-26-20-32(41)37-33(26)31/h1,6-10,19,21,27,36H,11-18,20H2,2-4H3,(H,37,41)/b25-6-,30-8+ |
| InChIKey | MDKDZURFIZCRSY-LSDIVJLFSA-N |
| XLogP | 4.62 |
| TPSA | 91.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|