C33H39N5O2 — CID 155322545
(E,2E)-2-ethylidene-3-[4-[5-[(3R)-3-(hydroxymethyl)-4-phenylpiperazine-1-carbonyl]-2,4-dimethylanilino]piperidin-1-yl]hex-3-en-5-ynenitrile (PubChem CID 155322545) has the molecular formula C33H39N5O2 and a molecular weight of 537.71 g/mol. Its IUPAC name is (E,2E)-2-ethylidene-3-[4-[5-[(3R)-3-(hydroxymethyl)-4-phenylpiperazine-1-carbonyl]-2,4-dimethylanilino]piperidin-1-yl]hex-3-en-5-ynenitrile.
| Compound Name | (E,2E)-2-ethylidene-3-[4-[5-[(3R)-3-(hydroxymethyl)-4-phenylpiperazine-1-carbonyl]-2,4-dimethylanilino]piperidin-1-yl]hex-3-en-5-ynenitrile |
|---|---|
| PubChem CID | 155322545 |
| Molecular Formula | C33H39N5O2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | (E,2E)-2-ethylidene-3-[4-[5-[(3R)-3-(hydroxymethyl)-4-phenylpiperazine-1-carbonyl]-2,4-dimethylanilino]piperidin-1-yl]hex-3-en-5-ynenitrile |
| SMILES | C#C/C=C(C(\C#N)=C/C)/N1CCC(Nc2cc(C(=O)N3CCN(c4ccccc4)[C@@H](CO)C3)c(C)cc2C)CC1 |
| InChI | InChI=1S/C33H39N5O2/c1-5-10-32(26(6-2)21-34)36-15-13-27(14-16-36)35-31-20-30(24(3)19-25(31)4)33(40)37-17-18-38(29(22-37)23-39)28-11-8-7-9-12-28/h1,6-12,19-20,27,29,35,39H,13-18,22-23H2,2-4H3/b26-6-,32-10+/t29-/m1/s1 |
| InChIKey | WXOTXYUNIWARNB-NJLUUJAGSA-N |
| XLogP | 4.49 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|