C21H28 — CID 142353001
ethane;(9Z)-9-ethylidene-1,4-dimethylphenalene (PubChem CID 142353001) has the molecular formula C21H28 and a molecular weight of 280.45 g/mol. Its IUPAC name is ethane;(9Z)-9-ethylidene-1,4-dimethylphenalene.
| Compound Name | ethane;(9Z)-9-ethylidene-1,4-dimethylphenalene |
|---|---|
| PubChem CID | 142353001 |
| Molecular Formula | C21H28 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | ethane;(9Z)-9-ethylidene-1,4-dimethylphenalene |
| SMILES | C/C=c1/ccc2ccc(C)c3ccc(C)c1c23.CC.CC |
| InChI | InChI=1S/C17H16.2C2H6/c1-4-13-8-9-14-7-5-11(2)15-10-6-12(3)16(13)17(14)15;2*1-2/h4-10H,1-3H3;2*1-2H3/b13-4-;; |
| InChIKey | AHTYZLDEZGWHRL-OTUVBFGZSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |