C50H52 — CID 160905157
(5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;(2Z,3Z)-2,3-di(ethylidene)naphthalene;(1Z)-1-ethylidene-9-methylphenalene;1-methyl-2-[(Z)-prop-1-enyl]benzene (PubChem CID 160905157) has the molecular formula C50H52 and a molecular weight of 652.97 g/mol. Its IUPAC name is (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;(2Z,3Z)-2,3-di(ethylidene)naphthalene;(1Z)-1-ethylidene-9-methylphenalene;1-methyl-2-[(Z)-prop-1-enyl]benzene.
| Compound Name | (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;(2Z,3Z)-2,3-di(ethylidene)naphthalene;(1Z)-1-ethylidene-9-methylphenalene;1-methyl-2-[(Z)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 160905157 |
| Molecular Formula | C50H52 |
| Molecular Weight | 652.97 g/mol |
| Exact Mass | 652.41 |
| IUPAC Name | (5Z,6Z)-5,6-di(ethylidene)cyclohexa-1,3-diene;(2Z,3Z)-2,3-di(ethylidene)naphthalene;(1Z)-1-ethylidene-9-methylphenalene;1-methyl-2-[(Z)-prop-1-enyl]benzene |
| SMILES | C/C=C\c1ccccc1C.C/C=c1/cc2ccccc2c/c1=C/C.C/C=c1/ccc2cccc3ccc(C)c1c32.C/C=c1/cccc/c1=C/C |
| InChI | InChI=1S/C16H14.C14H14.2C10H12/c1-3-12-9-10-14-6-4-5-13-8-7-11(2)15(12)16(13)14;1-3-11-9-13-7-5-6-8-14(13)10-12(11)4-2;1-3-6-10-8-5-4-7-9(10)2;1-3-9-7-5-6-8-10(9)4-2/h3-10H,1-2H3;3-10H,1-2H3;2*3-8H,1-2H3/b12-3-;11-3-,12-4-;6-3-;9-3-,10-4- |
| InChIKey | SQASDEVKRLKRGL-ZORQAJSKSA-N |
| XLogP | 10.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.97 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |