C40H35NO2S — CID 142354615
N-[diphenyl(propan-2-yl)-λ4-sulfanyl]-8-oxo-7-phenyl-N-propan-2-ylcyclopenta[a]acenaphthylene-9-carboxamide (PubChem CID 142354615) has the molecular formula C40H35NO2S and a molecular weight of 593.79 g/mol. Its IUPAC name is N-[diphenyl(propan-2-yl)-λ4-sulfanyl]-8-oxo-7-phenyl-N-propan-2-ylcyclopenta[a]acenaphthylene-9-carboxamide.
| Compound Name | N-[diphenyl(propan-2-yl)-λ4-sulfanyl]-8-oxo-7-phenyl-N-propan-2-ylcyclopenta[a]acenaphthylene-9-carboxamide |
|---|---|
| PubChem CID | 142354615 |
| Molecular Formula | C40H35NO2S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | N-[diphenyl(propan-2-yl)-λ4-sulfanyl]-8-oxo-7-phenyl-N-propan-2-ylcyclopenta[a]acenaphthylene-9-carboxamide |
| SMILES | CC(C)N(C(=O)C1=C2C(=C(c3ccccc3)C1=O)c1cccc3cccc2c13)S(c1ccccc1)(c1ccccc1)C(C)C |
| InChI | InChI=1S/C40H35NO2S/c1-26(2)41(44(27(3)4,30-20-10-6-11-21-30)31-22-12-7-13-23-31)40(43)38-37-33-25-15-19-28-18-14-24-32(34(28)33)36(37)35(39(38)42)29-16-8-5-9-17-29/h5-27H,1-4H3 |
| InChIKey | ODFWHURXBIESHG-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|