C43H37NO2S — CID 144977269
cumene;8-oxo-7-phenyl-N-(3-phenylsulfanylprop-2-ynyl)-N-propan-2-ylcyclopenta[a]acenaphthylene-9-carboxamide (PubChem CID 144977269) has the molecular formula C43H37NO2S and a molecular weight of 631.84 g/mol. Its IUPAC name is cumene;8-oxo-7-phenyl-N-(3-phenylsulfanylprop-2-ynyl)-N-propan-2-ylcyclopenta[a]acenaphthylene-9-carboxamide.
| Compound Name | cumene;8-oxo-7-phenyl-N-(3-phenylsulfanylprop-2-ynyl)-N-propan-2-ylcyclopenta[a]acenaphthylene-9-carboxamide |
|---|---|
| PubChem CID | 144977269 |
| Molecular Formula | C43H37NO2S |
| Molecular Weight | 631.84 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | cumene;8-oxo-7-phenyl-N-(3-phenylsulfanylprop-2-ynyl)-N-propan-2-ylcyclopenta[a]acenaphthylene-9-carboxamide |
| SMILES | CC(C)N(CC#CSc1ccccc1)C(=O)C1=C2C(=C(c3ccccc3)C1=O)c1cccc3cccc2c13.CC(C)c1ccccc1 |
| InChI | InChI=1S/C34H25NO2S.C9H12/c1-22(2)35(20-11-21-38-25-16-7-4-8-17-25)34(37)32-31-27-19-10-15-23-14-9-18-26(28(23)27)30(31)29(33(32)36)24-12-5-3-6-13-24;1-8(2)9-6-4-3-5-7-9/h3-10,12-19,22H,20H2,1-2H3;3-8H,1-2H3 |
| InChIKey | BMJOTMARNKUZFA-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.84 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|