C24H23N5OS — CID 142357205
8-N-ethenylsulfanyl-5-(4-phenoxyphenyl)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizine-4,8-diamine (PubChem CID 142357205) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is 8-N-ethenylsulfanyl-5-(4-phenoxyphenyl)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizine-4,8-diamine.
| Compound Name | 8-N-ethenylsulfanyl-5-(4-phenoxyphenyl)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizine-4,8-diamine |
|---|---|
| PubChem CID | 142357205 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 8-N-ethenylsulfanyl-5-(4-phenoxyphenyl)-6,7,8,9-tetrahydropyrimido[5,4-b]indolizine-4,8-diamine |
| SMILES | C=CSNC1CCc2c(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc3n2C1 |
| InChI | InChI=1S/C24H23N5OS/c1-2-31-28-17-10-13-20-21(22-23(25)26-15-27-24(22)29(20)14-17)16-8-11-19(12-9-16)30-18-6-4-3-5-7-18/h2-9,11-12,15,17,28H,1,10,13-14H2,(H2,25,26,27) |
| InChIKey | NQDXLRIOQAQYDX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|