C23H22N6O — CID 71721598
N-[(13S)-6-amino-8-quinolin-3-yl-1,3,5-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-13-yl]prop-2-enamide (PubChem CID 71721598) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[(13S)-6-amino-8-quinolin-3-yl-1,3,5-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-13-yl]prop-2-enamide.
| Compound Name | N-[(13S)-6-amino-8-quinolin-3-yl-1,3,5-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-13-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71721598 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[(13S)-6-amino-8-quinolin-3-yl-1,3,5-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-13-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCCc2c(-c3cnc4ccccc4c3)c3c(N)ncnc3n2C1 |
| InChI | InChI=1S/C23H22N6O/c1-2-19(30)28-16-7-5-9-18-20(15-10-14-6-3-4-8-17(14)25-11-15)21-22(24)26-13-27-23(21)29(18)12-16/h2-4,6,8,10-11,13,16H,1,5,7,9,12H2,(H,28,30)(H2,24,26,27)/t16-/m0/s1 |
| InChIKey | RWIKIGJGPDMUMW-INIZCTEOSA-N |
| XLogP | 3.24 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|