C23H20N6O — CID 121433749
N-(4-amino-6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-7-yl)-N-methylprop-2-enamide (PubChem CID 121433749) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(4-amino-6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-7-yl)-N-methylprop-2-enamide.
| Compound Name | N-(4-amino-6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-7-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 121433749 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(4-amino-6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-7-yl)-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)C1Cn2c(c(-c3cnc4ccccc4c3)c3c(N)ncnc32)C1=C |
| InChI | InChI=1S/C23H20N6O/c1-4-18(30)28(3)17-11-29-21(13(17)2)19(20-22(24)26-12-27-23(20)29)15-9-14-7-5-6-8-16(14)25-10-15/h4-10,12,17H,1-2,11H2,3H3,(H2,24,26,27) |
| InChIKey | AABPHMBNZZDIHO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|