C25H27N7O — CID 144794405
(E)-4-(dimethylamino)but-2-enamide;6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-4-amine (PubChem CID 144794405) has the molecular formula C25H27N7O and a molecular weight of 441.54 g/mol. Its IUPAC name is (E)-4-(dimethylamino)but-2-enamide;6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-4-amine.
| Compound Name | (E)-4-(dimethylamino)but-2-enamide;6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-4-amine |
|---|---|
| PubChem CID | 144794405 |
| Molecular Formula | C25H27N7O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (E)-4-(dimethylamino)but-2-enamide;6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-4-amine |
| SMILES | C=C1CCn2c1c(-c1cnc3ccccc3c1)c1c(N)ncnc12.CN(C)C/C=C/C(N)=O |
| InChI | InChI=1S/C19H15N5.C6H12N2O/c1-11-6-7-24-17(11)15(16-18(20)22-10-23-19(16)24)13-8-12-4-2-3-5-14(12)21-9-13;1-8(2)5-3-4-6(7)9/h2-5,8-10H,1,6-7H2,(H2,20,22,23);3-4H,5H2,1-2H3,(H2,7,9)/b;4-3+ |
| InChIKey | KJIQSPRKFODFGJ-SCBDLNNBSA-N |
| XLogP | 3.24 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|