C28H31N7O — CID 144794388
6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-4-amine;(E)-4-piperidin-1-ylbut-2-enamide (PubChem CID 144794388) has the molecular formula C28H31N7O and a molecular weight of 481.60 g/mol. Its IUPAC name is 6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-4-amine;(E)-4-piperidin-1-ylbut-2-enamide.
| Compound Name | 6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-4-amine;(E)-4-piperidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 144794388 |
| Molecular Formula | C28H31N7O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 6-methylidene-5-quinolin-3-yl-7,8-dihydropyrimido[5,4-b]pyrrolizin-4-amine;(E)-4-piperidin-1-ylbut-2-enamide |
| SMILES | C=C1CCn2c1c(-c1cnc3ccccc3c1)c1c(N)ncnc12.NC(=O)/C=C/CN1CCCCC1 |
| InChI | InChI=1S/C19H15N5.C9H16N2O/c1-11-6-7-24-17(11)15(16-18(20)22-10-23-19(16)24)13-8-12-4-2-3-5-14(12)21-9-13;10-9(12)5-4-8-11-6-2-1-3-7-11/h2-5,8-10H,1,6-7H2,(H2,20,22,23);4-5H,1-3,6-8H2,(H2,10,12)/b;5-4+ |
| InChIKey | UIAIIQOWNOKAFB-RCKHEGBHSA-N |
| XLogP | 4.16 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|