C22H22N6O — CID 144794394
6-methyl-5-quinolin-3-yl-7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizin-4-amine;prop-2-enamide (PubChem CID 144794394) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 6-methyl-5-quinolin-3-yl-7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizin-4-amine;prop-2-enamide.
| Compound Name | 6-methyl-5-quinolin-3-yl-7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizin-4-amine;prop-2-enamide |
|---|---|
| PubChem CID | 144794394 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 6-methyl-5-quinolin-3-yl-7,8-dihydro-6H-pyrimido[5,4-b]pyrrolizin-4-amine;prop-2-enamide |
| SMILES | C=CC(N)=O.CC1CCn2c1c(-c1cnc3ccccc3c1)c1c(N)ncnc12 |
| InChI | InChI=1S/C19H17N5.C3H5NO/c1-11-6-7-24-17(11)15(16-18(20)22-10-23-19(16)24)13-8-12-4-2-3-5-14(12)21-9-13;1-2-3(4)5/h2-5,8-11H,6-7H2,1H3,(H2,20,22,23);2H,1H2,(H2,4,5) |
| InChIKey | SMHUERMQOQJLMX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|