C29H35N — CID 142357545
ethane;2-ethenyl-3,6-dimethyl-1,6-diphenylcyclohepta[b]pyrrole (PubChem CID 142357545) has the molecular formula C29H35N and a molecular weight of 397.61 g/mol. Its IUPAC name is ethane;2-ethenyl-3,6-dimethyl-1,6-diphenylcyclohepta[b]pyrrole.
| Compound Name | ethane;2-ethenyl-3,6-dimethyl-1,6-diphenylcyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 142357545 |
| Molecular Formula | C29H35N |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | ethane;2-ethenyl-3,6-dimethyl-1,6-diphenylcyclohepta[b]pyrrole |
| SMILES | C=Cc1c(C)c2c(n1-c1ccccc1)C=CC(C)(c1ccccc1)C=C2.CC.CC |
| InChI | InChI=1S/C25H23N.2C2H6/c1-4-23-19(2)22-15-17-25(3,20-11-7-5-8-12-20)18-16-24(22)26(23)21-13-9-6-10-14-21;2*1-2/h4-18H,1H2,2-3H3;2*1-2H3 |
| InChIKey | HHUODNSKPBHDDD-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |