C21H27N — CID 142357623
N-(4-cyclohexylphenyl)-2,4,6-trimethylaniline (PubChem CID 142357623) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-2,4,6-trimethylaniline.
| Compound Name | N-(4-cyclohexylphenyl)-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 142357623 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-(4-cyclohexylphenyl)-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(Nc2ccc(C3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H27N/c1-15-13-16(2)21(17(3)14-15)22-20-11-9-19(10-12-20)18-7-5-4-6-8-18/h9-14,18,22H,4-8H2,1-3H3 |
| InChIKey | QSWTVDVCOSAFKH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |