C24H30N2O2 — CID 43021818
4-cyclohexyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide (PubChem CID 43021818) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-cyclohexyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide.
| Compound Name | 4-cyclohexyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 43021818 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-cyclohexyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)c2ccc(C3CCCCC3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H30N2O2/c1-16-13-17(2)23(18(3)14-16)26-22(27)15-25-24(28)21-11-9-20(10-12-21)19-7-5-4-6-8-19/h9-14,19H,4-8,15H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | ZQCKLWNWZMYLPO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |