C17H17ClO6 — CID 142357849
pentyl 2-chloro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate (PubChem CID 142357849) has the molecular formula C17H17ClO6 and a molecular weight of 352.77 g/mol. Its IUPAC name is pentyl 2-chloro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate.
| Compound Name | pentyl 2-chloro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate |
|---|---|
| PubChem CID | 142357849 |
| Molecular Formula | C17H17ClO6 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | pentyl 2-chloro-3,4,6-trihydroxy-5-oxobenzo[7]annulene-8-carboxylate |
| SMILES | CCCCCOC(=O)c1cc(O)c(=O)c2c(O)c(O)c(Cl)cc2c1 |
| InChI | InChI=1S/C17H17ClO6/c1-2-3-4-5-24-17(23)10-6-9-7-11(18)14(20)16(22)13(9)15(21)12(19)8-10/h6-8,20,22H,2-5H2,1H3,(H,19,21) |
| InChIKey | FHDBQVATGIDTSH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|