C10H17FN2O3S — CID 142359161
ethane;3-(5-fluoropyrimidin-2-yl)butane-2-sulfonic acid (PubChem CID 142359161) has the molecular formula C10H17FN2O3S and a molecular weight of 264.32 g/mol. Its IUPAC name is ethane;3-(5-fluoropyrimidin-2-yl)butane-2-sulfonic acid.
| Compound Name | ethane;3-(5-fluoropyrimidin-2-yl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 142359161 |
| Molecular Formula | C10H17FN2O3S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | ethane;3-(5-fluoropyrimidin-2-yl)butane-2-sulfonic acid |
| SMILES | CC.CC(c1ncc(F)cn1)C(C)S(=O)(=O)O |
| InChI | InChI=1S/C8H11FN2O3S.C2H6/c1-5(6(2)15(12,13)14)8-10-3-7(9)4-11-8;1-2/h3-6H,1-2H3,(H,12,13,14);1-2H3 |
| InChIKey | ICFNUSRYFMLVBP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|