C10H15FN2OS — CID 155417580
(3R,4R)-4-(5-fluoropyrimidin-2-yl)-1-methoxypentane-3-thiol (PubChem CID 155417580) has the molecular formula C10H15FN2OS and a molecular weight of 230.31 g/mol. Its IUPAC name is (3R,4R)-4-(5-fluoropyrimidin-2-yl)-1-methoxypentane-3-thiol.
| Compound Name | (3R,4R)-4-(5-fluoropyrimidin-2-yl)-1-methoxypentane-3-thiol |
|---|---|
| PubChem CID | 155417580 |
| Molecular Formula | C10H15FN2OS |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (3R,4R)-4-(5-fluoropyrimidin-2-yl)-1-methoxypentane-3-thiol |
| SMILES | COCC[C@@H](S)[C@H](C)c1ncc(F)cn1 |
| InChI | InChI=1S/C10H15FN2OS/c1-7(9(15)3-4-14-2)10-12-5-8(11)6-13-10/h5-7,9,15H,3-4H2,1-2H3/t7-,9+/m0/s1 |
| InChIKey | ASYBJJZUNJHQEC-IONNQARKSA-N |
| XLogP | 2.05 |
| TPSA | 35.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|