C22H24FN3O3S — CID 142359421
2-[bis[(4-methoxyphenyl)methyl]amino]sulfanyl-1-(5-fluoropyrimidin-2-yl)ethanol (PubChem CID 142359421) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[bis[(4-methoxyphenyl)methyl]amino]sulfanyl-1-(5-fluoropyrimidin-2-yl)ethanol.
| Compound Name | 2-[bis[(4-methoxyphenyl)methyl]amino]sulfanyl-1-(5-fluoropyrimidin-2-yl)ethanol |
|---|---|
| PubChem CID | 142359421 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-[bis[(4-methoxyphenyl)methyl]amino]sulfanyl-1-(5-fluoropyrimidin-2-yl)ethanol |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)SCC(O)c2ncc(F)cn2)cc1 |
| InChI | InChI=1S/C22H24FN3O3S/c1-28-19-7-3-16(4-8-19)13-26(14-17-5-9-20(29-2)10-6-17)30-15-21(27)22-24-11-18(23)12-25-22/h3-12,21,27H,13-15H2,1-2H3 |
| InChIKey | XBBULMNPJZPCGM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|