C24H41FN2OS — CID 142360116
1-[6-[1-(4-fluorophenyl)ethylamino]sulfanylhexylamino]hexan-2-one;methylcyclopropane (PubChem CID 142360116) has the molecular formula C24H41FN2OS and a molecular weight of 424.67 g/mol. Its IUPAC name is 1-[6-[1-(4-fluorophenyl)ethylamino]sulfanylhexylamino]hexan-2-one;methylcyclopropane.
| Compound Name | 1-[6-[1-(4-fluorophenyl)ethylamino]sulfanylhexylamino]hexan-2-one;methylcyclopropane |
|---|---|
| PubChem CID | 142360116 |
| Molecular Formula | C24H41FN2OS |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | 1-[6-[1-(4-fluorophenyl)ethylamino]sulfanylhexylamino]hexan-2-one;methylcyclopropane |
| SMILES | CC1CC1.CCCCC(=O)CNCCCCCCSNC(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H33FN2OS.C4H8/c1-3-4-9-20(24)16-22-14-7-5-6-8-15-25-23-17(2)18-10-12-19(21)13-11-18;1-4-2-3-4/h10-13,17,22-23H,3-9,14-16H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | OOPVWBIWTLRSPG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|