About cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine
cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine (PubChem CID 142360077) has the molecular formula C18H33N3S
and a molecular weight of 323.55 g/mol. Its IUPAC name is cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine.
Molecular Properties
| Compound Name | cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine |
| PubChem CID | 142360077 |
| Molecular Formula | C18H33N3S |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine |
| SMILES | Cc1ccc([C@H](C)NSCCCCCN)cc1.NCC1CC1 |
| InChI | InChI=1S/C14H24N2S.C4H9N/c1-12-6-8-14(9-7-12)13(2)16-17-11-5-3-4-10-15;5-3-4-1-2-4/h6-9,13,16H,3-5,10-11,15H2,1-2H3;4H,1-3,5H2/t13-;/m0./s1 |
| InChIKey | WDHYCTJWUHFEFH-ZOWNYOTGSA-N |
| XLogP | 3.78 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine?
The IUPAC name of cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine (CID 142360077) is cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine.
What is the SMILES notation for cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine?
The canonical SMILES for cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine is Cc1ccc([C@H](C)NSCCCCCN)cc1.NCC1CC1.
What is the InChIKey of cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine?
The InChIKey is WDHYCTJWUHFEFH-ZOWNYOTGSA-N. The full InChI is InChI=1S/C14H24N2S.C4H9N/c1-12-6-8-14(9-7-12)13(2)16-17-11-5-3-4-10-15;5-3-4-1-2-4/h6-9,13,16H,3-5,10-11,15H2,1-2H3;4H,1-3,5H2/t13-;/m0./s1.
What are the key properties of cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine?
cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine has a molecular weight of 323.55 g/mol, XLogP of 3.78, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine is sourced from PubChem (CID 142360077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).