C18H33N3S — CID 142360077
cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine (PubChem CID 142360077) has the molecular formula C18H33N3S and a molecular weight of 323.55 g/mol. Its IUPAC name is cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine.
| Compound Name | cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine |
|---|---|
| PubChem CID | 142360077 |
| Molecular Formula | C18H33N3S |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | cyclopropylmethanamine;5-[[(1S)-1-(4-methylphenyl)ethyl]amino]sulfanylpentan-1-amine |
| SMILES | Cc1ccc([C@H](C)NSCCCCCN)cc1.NCC1CC1 |
| InChI | InChI=1S/C14H24N2S.C4H9N/c1-12-6-8-14(9-7-12)13(2)16-17-11-5-3-4-10-15;5-3-4-1-2-4/h6-9,13,16H,3-5,10-11,15H2,1-2H3;4H,1-3,5H2/t13-;/m0./s1 |
| InChIKey | WDHYCTJWUHFEFH-ZOWNYOTGSA-N |
| XLogP | 3.78 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|