C19H30FN3O2S — CID 135198034
2-[5-[[(1S)-1-[3-(cyclopropylmethoxy)-2-fluorophenyl]ethyl]amino]sulfanylpentylamino]acetamide (PubChem CID 135198034) has the molecular formula C19H30FN3O2S and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-[5-[[(1S)-1-[3-(cyclopropylmethoxy)-2-fluorophenyl]ethyl]amino]sulfanylpentylamino]acetamide.
| Compound Name | 2-[5-[[(1S)-1-[3-(cyclopropylmethoxy)-2-fluorophenyl]ethyl]amino]sulfanylpentylamino]acetamide |
|---|---|
| PubChem CID | 135198034 |
| Molecular Formula | C19H30FN3O2S |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-[5-[[(1S)-1-[3-(cyclopropylmethoxy)-2-fluorophenyl]ethyl]amino]sulfanylpentylamino]acetamide |
| SMILES | C[C@H](NSCCCCCNCC(N)=O)c1cccc(OCC2CC2)c1F |
| InChI | InChI=1S/C19H30FN3O2S/c1-14(23-26-11-4-2-3-10-22-12-18(21)24)16-6-5-7-17(19(16)20)25-13-15-8-9-15/h5-7,14-15,22-23H,2-4,8-13H2,1H3,(H2,21,24)/t14-/m0/s1 |
| InChIKey | ILBNPBQMGQMSLJ-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|