About ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine
ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine (PubChem CID 142361446) has the molecular formula C13H34N2O3S
and a molecular weight of 298.49 g/mol. Its IUPAC name is ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine.
Molecular Properties
| Compound Name | ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine |
| PubChem CID | 142361446 |
| Molecular Formula | C13H34N2O3S |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine |
| SMILES | CC.CC.CC(=O)CCNCCCOCCO.NS |
| InChI | InChI=1S/C9H19NO3.2C2H6.H3NS/c1-9(12)3-5-10-4-2-7-13-8-6-11;3*1-2/h10-11H,2-8H2,1H3;2*1-2H3;2H,1H2 |
| InChIKey | QXNQYHXKRYOVMS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine?
The IUPAC name of ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine (CID 142361446) is ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine.
What is the SMILES notation for ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine?
The canonical SMILES for ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine is CC.CC.CC(=O)CCNCCCOCCO.NS.
What is the InChIKey of ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine?
The InChIKey is QXNQYHXKRYOVMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3.2C2H6.H3NS/c1-9(12)3-5-10-4-2-7-13-8-6-11;3*1-2/h10-11H,2-8H2,1H3;2*1-2H3;2H,1H2.
What are the key properties of ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine?
ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine has a molecular weight of 298.49 g/mol, XLogP of 1.80, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[3-(2-hydroxyethoxy)propylamino]butan-2-one;thiohydroxylamine is sourced from PubChem (CID 142361446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).