C14H24N2 — CID 142361503
2-tert-butyl-5-(2,2-dimethylbutyl)pyrazine (PubChem CID 142361503) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,2-dimethylbutyl)pyrazine.
| Compound Name | 2-tert-butyl-5-(2,2-dimethylbutyl)pyrazine |
|---|---|
| PubChem CID | 142361503 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2-tert-butyl-5-(2,2-dimethylbutyl)pyrazine |
| SMILES | CCC(C)(C)Cc1cnc(C(C)(C)C)cn1 |
| InChI | InChI=1S/C14H24N2/c1-7-14(5,6)8-11-9-16-12(10-15-11)13(2,3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey | RZSTZFVRFCUJNL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |