About 5-tert-butyl-N,N-diethylpyrazin-2-amine
5-tert-butyl-N,N-diethylpyrazin-2-amine (PubChem CID 67967134) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 5-tert-butyl-N,N-diethylpyrazin-2-amine.
Molecular Properties
| Compound Name | 5-tert-butyl-N,N-diethylpyrazin-2-amine |
| PubChem CID | 67967134 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 5-tert-butyl-N,N-diethylpyrazin-2-amine |
| SMILES | CCN(CC)c1cnc(C(C)(C)C)cn1 |
| InChI | InChI=1S/C12H21N3/c1-6-15(7-2)11-9-13-10(8-14-11)12(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | XQKKBHZDIJCKQN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-N,N-diethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N,N-diethylpyrazin-2-amine?
The IUPAC name of 5-tert-butyl-N,N-diethylpyrazin-2-amine (CID 67967134) is 5-tert-butyl-N,N-diethylpyrazin-2-amine.
What is the SMILES notation for 5-tert-butyl-N,N-diethylpyrazin-2-amine?
The canonical SMILES for 5-tert-butyl-N,N-diethylpyrazin-2-amine is CCN(CC)c1cnc(C(C)(C)C)cn1.
What is the InChIKey of 5-tert-butyl-N,N-diethylpyrazin-2-amine?
The InChIKey is XQKKBHZDIJCKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-6-15(7-2)11-9-13-10(8-14-11)12(3,4)5/h8-9H,6-7H2,1-5H3.
What are the key properties of 5-tert-butyl-N,N-diethylpyrazin-2-amine?
5-tert-butyl-N,N-diethylpyrazin-2-amine has a molecular weight of 207.32 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N,N-diethylpyrazin-2-amine is sourced from PubChem (CID 67967134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).