C12H21N3 — CID 67967134
5-tert-butyl-N,N-diethylpyrazin-2-amine (PubChem CID 67967134) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 5-tert-butyl-N,N-diethylpyrazin-2-amine.
| Compound Name | 5-tert-butyl-N,N-diethylpyrazin-2-amine |
|---|---|
| PubChem CID | 67967134 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 5-tert-butyl-N,N-diethylpyrazin-2-amine |
| SMILES | CCN(CC)c1cnc(C(C)(C)C)cn1 |
| InChI | InChI=1S/C12H21N3/c1-6-15(7-2)11-9-13-10(8-14-11)12(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | XQKKBHZDIJCKQN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |