C20H39N3Sn — CID 59694015
N,N-diethyl-5-tributylstannylpyrazin-2-amine (PubChem CID 59694015) has the molecular formula C20H39N3Sn and a molecular weight of 440.26 g/mol. Its IUPAC name is N,N-diethyl-5-tributylstannylpyrazin-2-amine.
| Compound Name | N,N-diethyl-5-tributylstannylpyrazin-2-amine |
|---|---|
| PubChem CID | 59694015 |
| Molecular Formula | C20H39N3Sn |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N,N-diethyl-5-tributylstannylpyrazin-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(N(CC)CC)cn1 |
| InChI | InChI=1S/C8H12N3.3C4H9.Sn/c1-3-11(4-2)8-7-9-5-6-10-8;3*1-3-4-2;/h6-7H,3-4H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | KJNAMGKCRITQCN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |