C24H38FN3Sn — CID 150159941
5-(6-fluoro-5-tributylstannyl-2-pyridinyl)-N,N-dimethylpyridin-2-amine (PubChem CID 150159941) has the molecular formula C24H38FN3Sn and a molecular weight of 506.30 g/mol. Its IUPAC name is 5-(6-fluoro-5-tributylstannyl-2-pyridinyl)-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-(6-fluoro-5-tributylstannyl-2-pyridinyl)-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 150159941 |
| Molecular Formula | C24H38FN3Sn |
| Molecular Weight | 506.30 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 5-(6-fluoro-5-tributylstannyl-2-pyridinyl)-N,N-dimethylpyridin-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(-c2ccc(N(C)C)nc2)nc1F |
| InChI | InChI=1S/C12H11FN3.3C4H9.Sn/c1-16(2)12-7-6-9(8-14-12)10-4-3-5-11(13)15-10;3*1-3-4-2;/h3-4,6-8H,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | FHAUWBXHBKGSPW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.30 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|