C18H33N3 — CID 43782595
2-N,2-N-dimethyl-5-N-undecan-6-ylpyridine-2,5-diamine (PubChem CID 43782595) has the molecular formula C18H33N3 and a molecular weight of 291.48 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-5-N-undecan-6-ylpyridine-2,5-diamine.
| Compound Name | 2-N,2-N-dimethyl-5-N-undecan-6-ylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 43782595 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | 2-N,2-N-dimethyl-5-N-undecan-6-ylpyridine-2,5-diamine |
| SMILES | CCCCCC(CCCCC)Nc1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C18H33N3/c1-5-7-9-11-16(12-10-8-6-2)20-17-13-14-18(19-15-17)21(3)4/h13-16,20H,5-12H2,1-4H3 |
| InChIKey | CIRFGQPEZFLAAX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|