About 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine
5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine (PubChem CID 82104382) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine.
Molecular Properties
| Compound Name | 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine |
| PubChem CID | 82104382 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine |
| SMILES | CCCCCC(CC)Nc1ccc(NCC)cn1 |
| InChI | InChI=1S/C15H27N3/c1-4-7-8-9-13(5-2)18-15-11-10-14(12-17-15)16-6-3/h10-13,16H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | UVQUWLCYYZYPGB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine?
The IUPAC name of 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine (CID 82104382) is 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine.
What is the SMILES notation for 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine?
The canonical SMILES for 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine is CCCCCC(CC)Nc1ccc(NCC)cn1.
What is the InChIKey of 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine?
The InChIKey is UVQUWLCYYZYPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3/c1-4-7-8-9-13(5-2)18-15-11-10-14(12-17-15)16-6-3/h10-13,16H,4-9H2,1-3H3,(H,17,18).
What are the key properties of 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine?
5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine has a molecular weight of 249.40 g/mol, XLogP of 4.28, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine is sourced from PubChem (CID 82104382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).