C15H27N3 — CID 82104382
5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine (PubChem CID 82104382) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine.
| Compound Name | 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 82104382 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 5-N-ethyl-2-N-octan-3-ylpyridine-2,5-diamine |
| SMILES | CCCCCC(CC)Nc1ccc(NCC)cn1 |
| InChI | InChI=1S/C15H27N3/c1-4-7-8-9-13(5-2)18-15-11-10-14(12-17-15)16-6-3/h10-13,16H,4-9H2,1-3H3,(H,17,18) |
| InChIKey | UVQUWLCYYZYPGB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|