C10H15N3 — CID 82104360
5-N-ethyl-2-N-prop-2-enylpyridine-2,5-diamine (PubChem CID 82104360) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-N-ethyl-2-N-prop-2-enylpyridine-2,5-diamine.
| Compound Name | 5-N-ethyl-2-N-prop-2-enylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 82104360 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 5-N-ethyl-2-N-prop-2-enylpyridine-2,5-diamine |
| SMILES | C=CCNc1ccc(NCC)cn1 |
| InChI | InChI=1S/C10H15N3/c1-3-7-12-10-6-5-9(8-13-10)11-4-2/h3,5-6,8,11H,1,4,7H2,2H3,(H,12,13) |
| InChIKey | GXRVYTHYTLNEAQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|