C10H14N4O — CID 39178299
2-amino-N-[5-(prop-2-enylamino)-2-pyridinyl]acetamide (PubChem CID 39178299) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-amino-N-[5-(prop-2-enylamino)-2-pyridinyl]acetamide.
| Compound Name | 2-amino-N-[5-(prop-2-enylamino)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 39178299 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-amino-N-[5-(prop-2-enylamino)-2-pyridinyl]acetamide |
| SMILES | C=CCNc1ccc(NC(=O)CN)nc1 |
| InChI | InChI=1S/C10H14N4O/c1-2-5-12-8-3-4-9(13-7-8)14-10(15)6-11/h2-4,7,12H,1,5-6,11H2,(H,13,14,15) |
| InChIKey | JFLDGNZKQUULSD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|