About 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate
2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate (PubChem CID 142364939) has the molecular formula C16H24N2O3V
and a molecular weight of 343.32 g/mol. Its IUPAC name is 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate.
Molecular Properties
| Compound Name | 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate |
| PubChem CID | 142364939 |
| Molecular Formula | C16H24N2O3V |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate |
| SMILES | CC(C)C#Cc1cnc(OC2CC(OC(C)C)C2)cn1.O.[V] |
| InChI | InChI=1S/C16H22N2O2.H2O.V/c1-11(2)5-6-13-9-18-16(10-17-13)20-15-7-14(8-15)19-12(3)4;;/h9-12,14-15H,7-8H2,1-4H3;1H2; |
| InChIKey | KIRLDMCSANGIJK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate?
The IUPAC name of 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate (CID 142364939) is 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate.
What is the SMILES notation for 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate?
The canonical SMILES for 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate is CC(C)C#Cc1cnc(OC2CC(OC(C)C)C2)cn1.O.[V].
What is the InChIKey of 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate?
The InChIKey is KIRLDMCSANGIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2.H2O.V/c1-11(2)5-6-13-9-18-16(10-17-13)20-15-7-14(8-15)19-12(3)4;;/h9-12,14-15H,7-8H2,1-4H3;1H2;.
What are the key properties of 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate?
2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate has a molecular weight of 343.32 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbut-1-ynyl)-5-(3-propan-2-yloxycyclobutyl)oxypyrazine;vanadium;hydrate is sourced from PubChem (CID 142364939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).