C15H27N3 — CID 142365384
(2Z,4E)-2,3-dimethyl-N-(3-piperazin-1-ylpropyl)hexa-2,4-dien-1-imine (PubChem CID 142365384) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is (2Z,4E)-2,3-dimethyl-N-(3-piperazin-1-ylpropyl)hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-2,3-dimethyl-N-(3-piperazin-1-ylpropyl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142365384 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (2Z,4E)-2,3-dimethyl-N-(3-piperazin-1-ylpropyl)hexa-2,4-dien-1-imine |
| SMILES | C/C=C/C(C)=C(C)\C=N\CCCN1CCNCC1 |
| InChI | InChI=1S/C15H27N3/c1-4-6-14(2)15(3)13-17-7-5-10-18-11-8-16-9-12-18/h4,6,13,16H,5,7-12H2,1-3H3/b6-4+,15-14-,17-13+ |
| InChIKey | IBWGMQBEPFVIHD-PRRFUTAWSA-N |
| XLogP | 2.27 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|