C25H28ClF2N3O6 — CID 142367185
N-[(3-chloro-2,4-difluorophenyl)methyl]-7-hydroxy-3-methoxy-10-(2-methoxyethyl)-12-methyl-6,9-dioxo-10,14-diazatricyclo[6.4.2.04,14]tetradeca-4,7-diene-5-carboxamide (PubChem CID 142367185) has the molecular formula C25H28ClF2N3O6 and a molecular weight of 539.96 g/mol. Its IUPAC name is N-[(3-chloro-2,4-difluorophenyl)methyl]-7-hydroxy-3-methoxy-10-(2-methoxyethyl)-12-methyl-6,9-dioxo-10,14-diazatricyclo[6.4.2.04,14]tetradeca-4,7-diene-5-carboxamide.
| Compound Name | N-[(3-chloro-2,4-difluorophenyl)methyl]-7-hydroxy-3-methoxy-10-(2-methoxyethyl)-12-methyl-6,9-dioxo-10,14-diazatricyclo[6.4.2.04,14]tetradeca-4,7-diene-5-carboxamide |
|---|---|
| PubChem CID | 142367185 |
| Molecular Formula | C25H28ClF2N3O6 |
| Molecular Weight | 539.96 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | N-[(3-chloro-2,4-difluorophenyl)methyl]-7-hydroxy-3-methoxy-10-(2-methoxyethyl)-12-methyl-6,9-dioxo-10,14-diazatricyclo[6.4.2.04,14]tetradeca-4,7-diene-5-carboxamide |
| SMILES | COCCN1CC(C)C2CC(OC)c3c(C(=O)NCc4ccc(F)c(Cl)c4F)c(=O)c(O)c(n3C2)C1=O |
| InChI | InChI=1S/C25H28ClF2N3O6/c1-12-10-30(6-7-36-2)25(35)21-23(33)22(32)17(20-16(37-3)8-14(12)11-31(20)21)24(34)29-9-13-4-5-15(27)18(26)19(13)28/h4-5,12,14,16,33H,6-11H2,1-3H3,(H,29,34) |
| InChIKey | DHFPIEOBKFHJLD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.96 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|