C15H28N2O — CID 142367368
N'-ethyl-N'-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-N-methylethane-1,2-diamine (PubChem CID 142367368) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is N'-ethyl-N'-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142367368 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N'-ethyl-N'-[4-[(3Z)-hexa-1,3,5-trien-2-yl]oxybutyl]-N-methylethane-1,2-diamine |
| SMILES | C=C/C=C\C(=C)OCCCCN(CC)CCNC |
| InChI | InChI=1S/C15H28N2O/c1-5-7-10-15(3)18-14-9-8-12-17(6-2)13-11-16-4/h5,7,10,16H,1,3,6,8-9,11-14H2,2,4H3/b10-7- |
| InChIKey | NWOJIJAQDKVBGM-YFHOEESVSA-N |
| XLogP | 2.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|