C17H30N2O3 — CID 142368291
ethane;1-[[6-[3-(methylamino)cyclobutyl]oxy-3-pyridinyl]oxy]propan-2-one (PubChem CID 142368291) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is ethane;1-[[6-[3-(methylamino)cyclobutyl]oxy-3-pyridinyl]oxy]propan-2-one.
| Compound Name | ethane;1-[[6-[3-(methylamino)cyclobutyl]oxy-3-pyridinyl]oxy]propan-2-one |
|---|---|
| PubChem CID | 142368291 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | ethane;1-[[6-[3-(methylamino)cyclobutyl]oxy-3-pyridinyl]oxy]propan-2-one |
| SMILES | CC.CC.CNC1CC(Oc2ccc(OCC(C)=O)cn2)C1 |
| InChI | InChI=1S/C13H18N2O3.2C2H6/c1-9(16)8-17-11-3-4-13(15-7-11)18-12-5-10(6-12)14-2;2*1-2/h3-4,7,10,12,14H,5-6,8H2,1-2H3;2*1-2H3 |
| InChIKey | OLHYRGDEHHAHRX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |