C16H28N2O2 — CID 142409721
ethane;4-[6-[3-(methylamino)cyclobutyl]oxy-3-pyridinyl]butan-2-one;molecular hydrogen (PubChem CID 142409721) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethane;4-[6-[3-(methylamino)cyclobutyl]oxy-3-pyridinyl]butan-2-one;molecular hydrogen.
| Compound Name | ethane;4-[6-[3-(methylamino)cyclobutyl]oxy-3-pyridinyl]butan-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 142409721 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | ethane;4-[6-[3-(methylamino)cyclobutyl]oxy-3-pyridinyl]butan-2-one;molecular hydrogen |
| SMILES | CC.CNC1CC(Oc2ccc(CCC(C)=O)cn2)C1.[H][H] |
| InChI | InChI=1S/C14H20N2O2.C2H6.H2/c1-10(17)3-4-11-5-6-14(16-9-11)18-13-7-12(8-13)15-2;1-2;/h5-6,9,12-13,15H,3-4,7-8H2,1-2H3;1-2H3;1H |
| InChIKey | CBEJTXBANAPJER-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |