C14H16ClNO — CID 142369519
3-[(2E,4E,6E)-7-chloro-4-methoxyocta-2,4,6-trien-3-yl]pyridine (PubChem CID 142369519) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is 3-[(2E,4E,6E)-7-chloro-4-methoxyocta-2,4,6-trien-3-yl]pyridine.
| Compound Name | 3-[(2E,4E,6E)-7-chloro-4-methoxyocta-2,4,6-trien-3-yl]pyridine |
|---|---|
| PubChem CID | 142369519 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-[(2E,4E,6E)-7-chloro-4-methoxyocta-2,4,6-trien-3-yl]pyridine |
| SMILES | C/C=C(C(=C\C=C(/C)Cl)/OC)\c1cccnc1 |
| InChI | InChI=1S/C14H16ClNO/c1-4-13(12-6-5-9-16-10-12)14(17-3)8-7-11(2)15/h4-10H,1-3H3/b11-7+,13-4+,14-8+ |
| InChIKey | IUJIIYCICHAKCF-CAWASENDSA-N |
| XLogP | 4.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|