C32H24N4 — CID 142370808
(Z)-N-[1-[4-(2-pyrido[1,2-b]indazol-7-ylquinolin-7-yl)phenyl]ethenyl]but-2-en-1-imine (PubChem CID 142370808) has the molecular formula C32H24N4 and a molecular weight of 464.57 g/mol. Its IUPAC name is (Z)-N-[1-[4-(2-pyrido[1,2-b]indazol-7-ylquinolin-7-yl)phenyl]ethenyl]but-2-en-1-imine.
| Compound Name | (Z)-N-[1-[4-(2-pyrido[1,2-b]indazol-7-ylquinolin-7-yl)phenyl]ethenyl]but-2-en-1-imine |
|---|---|
| PubChem CID | 142370808 |
| Molecular Formula | C32H24N4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (Z)-N-[1-[4-(2-pyrido[1,2-b]indazol-7-ylquinolin-7-yl)phenyl]ethenyl]but-2-en-1-imine |
| SMILES | C=C(/N=C/C=C\C)c1ccc(-c2ccc3ccc(-c4cccc5c6ccccc6nn45)nc3c2)cc1 |
| InChI | InChI=1S/C32H24N4/c1-3-4-20-33-22(2)23-12-14-24(15-13-23)26-17-16-25-18-19-29(34-30(25)21-26)32-11-7-10-31-27-8-5-6-9-28(27)35-36(31)32/h3-21H,2H2,1H3/b4-3-,33-20+ |
| InChIKey | USPRSIAOZRXSSL-TZEOGGCISA-N |
| XLogP | 7.99 |
| TPSA | 42.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|