C16H15FN4O2 — CID 142372340
N-[(Z)-1-amino-3-(1,3-oxazol-2-ylamino)prop-2-enylidene]-1-(2-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 142372340) has the molecular formula C16H15FN4O2 and a molecular weight of 314.32 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(1,3-oxazol-2-ylamino)prop-2-enylidene]-1-(2-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-(1,3-oxazol-2-ylamino)prop-2-enylidene]-1-(2-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142372340 |
| Molecular Formula | C16H15FN4O2 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[(Z)-1-amino-3-(1,3-oxazol-2-ylamino)prop-2-enylidene]-1-(2-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | NC(/C=C\Nc1ncco1)=N\C(=O)C1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H15FN4O2/c17-12-4-2-1-3-11(12)16(6-7-16)14(22)21-13(18)5-8-19-15-20-9-10-23-15/h1-5,8-10H,6-7H2,(H,19,20)(H2,18,21,22)/b8-5- |
| InChIKey | VPYBRXSOYXYBRE-YVMONPNESA-N |
| XLogP | 2.35 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|