C17H14N2O2 — CID 54014834
N-(1,3-oxazol-2-yl)-2-(2-phenylphenyl)acetamide (PubChem CID 54014834) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(1,3-oxazol-2-yl)-2-(2-phenylphenyl)acetamide.
| Compound Name | N-(1,3-oxazol-2-yl)-2-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 54014834 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(1,3-oxazol-2-yl)-2-(2-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccccc1-c1ccccc1)Nc1ncco1 |
| InChI | InChI=1S/C17H14N2O2/c20-16(19-17-18-10-11-21-17)12-14-8-4-5-9-15(14)13-6-2-1-3-7-13/h1-11H,12H2,(H,18,19,20) |
| InChIKey | KUXFHECIPVGKTD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |